C18H19FN2O2 — CID 51606045
N-[(2S)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-2-fluorobenzamide (PubChem CID 51606045) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[(2S)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(2S)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 51606045 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[(2S)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-2-fluorobenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H](C)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H19FN2O2/c1-11-7-6-8-12(2)16(11)21-17(22)13(3)20-18(23)14-9-4-5-10-15(14)19/h4-10,13H,1-3H3,(H,20,23)(H,21,22)/t13-/m0/s1 |
| InChIKey | CFRRSUBLCMYOSP-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |