C21H19FN2O3 — CID 3308582
N-[2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]-2-fluorobenzamide (PubChem CID 3308582) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3308582 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]-2-fluorobenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(NC(=O)c1ccccc1F)c1ccco1 |
| InChI | InChI=1S/C21H19FN2O3/c1-13-7-5-8-14(2)18(13)23-21(26)19(17-11-6-12-27-17)24-20(25)15-9-3-4-10-16(15)22/h3-12,19H,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | NPZHOZCSYRGTCP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |