C22H25FN2O2 — CID 1494005
N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]-2-fluorobenzamide (PubChem CID 1494005) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]-2-fluorobenzamide.
| Compound Name | N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 1494005 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]-2-fluorobenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1(NC(=O)c2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C22H25FN2O2/c1-15-9-8-10-16(2)19(15)24-21(27)22(13-6-3-7-14-22)25-20(26)17-11-4-5-12-18(17)23/h4-5,8-12H,3,6-7,13-14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | LLIBXWVIHJUHEA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |