C12H12FNO3 — CID 81164018
1-[(2-fluorobenzoyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 81164018) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-[(2-fluorobenzoyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2-fluorobenzoyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81164018 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-[(2-fluorobenzoyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC1)c1ccccc1F |
| InChI | InChI=1S/C12H12FNO3/c13-9-5-2-1-4-8(9)10(15)14-12(11(16)17)6-3-7-12/h1-2,4-5H,3,6-7H2,(H,14,15)(H,16,17) |
| InChIKey | FWSZGXPNOKADKU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |