C24H29FN2O2 — CID 86878946
N-(2-cyclohexylethyl)-2-[(2-fluorobenzoyl)amino]-N,3-dimethylbenzamide (PubChem CID 86878946) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-2-[(2-fluorobenzoyl)amino]-N,3-dimethylbenzamide.
| Compound Name | N-(2-cyclohexylethyl)-2-[(2-fluorobenzoyl)amino]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 86878946 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-(2-cyclohexylethyl)-2-[(2-fluorobenzoyl)amino]-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CCC2CCCCC2)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H29FN2O2/c1-17-9-8-13-20(22(17)26-23(28)19-12-6-7-14-21(19)25)24(29)27(2)16-15-18-10-4-3-5-11-18/h6-9,12-14,18H,3-5,10-11,15-16H2,1-2H3,(H,26,28) |
| InChIKey | VGVRBMZOFIPBDV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |