C20H21FN2O2S — CID 97319528
2-[(2-fluorobenzoyl)amino]-3-methyl-N-[(3S)-thian-3-yl]benzamide (PubChem CID 97319528) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)amino]-3-methyl-N-[(3S)-thian-3-yl]benzamide.
| Compound Name | 2-[(2-fluorobenzoyl)amino]-3-methyl-N-[(3S)-thian-3-yl]benzamide |
|---|---|
| PubChem CID | 97319528 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[(2-fluorobenzoyl)amino]-3-methyl-N-[(3S)-thian-3-yl]benzamide |
| SMILES | Cc1cccc(C(=O)N[C@H]2CCCSC2)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H21FN2O2S/c1-13-6-4-9-16(20(25)22-14-7-5-11-26-12-14)18(13)23-19(24)15-8-2-3-10-17(15)21/h2-4,6,8-10,14H,5,7,11-12H2,1H3,(H,22,25)(H,23,24)/t14-/m0/s1 |
| InChIKey | WNOLHSVFACAWFZ-AWEZNQCLSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |