C24H24FN3O2 — CID 86905072
N-(3-anilinopropyl)-2-[(2-fluorobenzoyl)amino]-3-methylbenzamide (PubChem CID 86905072) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-(3-anilinopropyl)-2-[(2-fluorobenzoyl)amino]-3-methylbenzamide.
| Compound Name | N-(3-anilinopropyl)-2-[(2-fluorobenzoyl)amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 86905072 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(3-anilinopropyl)-2-[(2-fluorobenzoyl)amino]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCCNc2ccccc2)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H24FN3O2/c1-17-9-7-13-20(22(17)28-24(30)19-12-5-6-14-21(19)25)23(29)27-16-8-15-26-18-10-3-2-4-11-18/h2-7,9-14,26H,8,15-16H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | HXANPEQEQAPVCO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|