C17H17ClFN3O2 — CID 47985502
N-[3-[(4-chlorophenyl)carbamoylamino]propyl]-2-fluorobenzamide (PubChem CID 47985502) has the molecular formula C17H17ClFN3O2 and a molecular weight of 349.79 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)carbamoylamino]propyl]-2-fluorobenzamide.
| Compound Name | N-[3-[(4-chlorophenyl)carbamoylamino]propyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 47985502 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[3-[(4-chlorophenyl)carbamoylamino]propyl]-2-fluorobenzamide |
| SMILES | O=C(NCCCNC(=O)c1ccccc1F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClFN3O2/c18-12-6-8-13(9-7-12)22-17(24)21-11-3-10-20-16(23)14-4-1-2-5-15(14)19/h1-2,4-9H,3,10-11H2,(H,20,23)(H2,21,22,24) |
| InChIKey | SDAKTLXHZXDYBA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|