C21H16ClFN2O2S — CID 20524501
N-[[4-[(4-chlorophenyl)methylsulfanyl]phenyl]carbamoyl]-2-fluorobenzamide (PubChem CID 20524501) has the molecular formula C21H16ClFN2O2S and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methylsulfanyl]phenyl]carbamoyl]-2-fluorobenzamide.
| Compound Name | N-[[4-[(4-chlorophenyl)methylsulfanyl]phenyl]carbamoyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 20524501 |
| Molecular Formula | C21H16ClFN2O2S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methylsulfanyl]phenyl]carbamoyl]-2-fluorobenzamide |
| SMILES | O=C(NC(=O)c1ccccc1F)Nc1ccc(SCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H16ClFN2O2S/c22-15-7-5-14(6-8-15)13-28-17-11-9-16(10-12-17)24-21(27)25-20(26)18-3-1-2-4-19(18)23/h1-12H,13H2,(H2,24,25,26,27) |
| InChIKey | OQAAGJSEGKNEPJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |