C23H22ClNOS2 — CID 28635750
(2R)-2-(4-chlorophenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]butanamide (PubChem CID 28635750) has the molecular formula C23H22ClNOS2 and a molecular weight of 428.02 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 28635750 |
| Molecular Formula | C23H22ClNOS2 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22ClNOS2/c1-2-22(28-21-14-10-18(24)11-15-21)23(26)25-19-12-8-17(9-13-19)16-27-20-6-4-3-5-7-20/h3-15,22H,2,16H2,1H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | WBZYXJATPUROMR-JOCHJYFZSA-N |
| XLogP | 7.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |