C18H20ClNOS2 — CID 92673326
(2R)-2-(4-chlorophenyl)sulfanyl-N-(2-ethylsulfanylphenyl)butanamide (PubChem CID 92673326) has the molecular formula C18H20ClNOS2 and a molecular weight of 365.95 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-(2-ethylsulfanylphenyl)butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-(2-ethylsulfanylphenyl)butanamide |
|---|---|
| PubChem CID | 92673326 |
| Molecular Formula | C18H20ClNOS2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-(2-ethylsulfanylphenyl)butanamide |
| SMILES | CCSc1ccccc1NC(=O)C(CC)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNOS2/c1-3-16(23-14-11-9-13(19)10-12-14)18(21)20-15-7-5-6-8-17(15)22-4-2/h5-12,16H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | AGJGERSSAGLPGA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |