C21H25ClN2O2S — CID 28570718
N-[(2S)-butan-2-yl]-2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]benzamide (PubChem CID 28570718) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]benzamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]benzamide |
|---|---|
| PubChem CID | 28570718 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]benzamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccccc1C(=O)N[C@@H](C)CC |
| InChI | InChI=1S/C21H25ClN2O2S/c1-4-14(3)23-20(25)17-8-6-7-9-18(17)24-21(26)19(5-2)27-16-12-10-15(22)11-13-16/h6-14,19H,4-5H2,1-3H3,(H,23,25)(H,24,26)/t14-,19-/m0/s1 |
| InChIKey | SPICBVBOTSEANE-LIRRHRJNSA-N |
| XLogP | 5.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |