C22H25ClN2O3S — CID 94018644
2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 94018644) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is 2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94018644 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[[(2S)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)Nc1ccccc1C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-2-20(29-17-11-9-15(23)10-12-17)22(27)25-19-8-4-3-7-18(19)21(26)24-14-16-6-5-13-28-16/h3-4,7-12,16,20H,2,5-6,13-14H2,1H3,(H,24,26)(H,25,27)/t16-,20?/m1/s1 |
| InChIKey | IOJQXAHTULYWHX-QRIPLOBPSA-N |
| XLogP | 4.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |