C20H24ClNOS — CID 92684645
(2S)-2-(4-chlorophenyl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]butanamide (PubChem CID 92684645) has the molecular formula C20H24ClNOS and a molecular weight of 361.94 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]butanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]butanamide |
|---|---|
| PubChem CID | 92684645 |
| Molecular Formula | C20H24ClNOS |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[(2R)-4-phenylbutan-2-yl]butanamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)N[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H24ClNOS/c1-3-19(24-18-13-11-17(21)12-14-18)20(23)22-15(2)9-10-16-7-5-4-6-8-16/h4-8,11-15,19H,3,9-10H2,1-2H3,(H,22,23)/t15-,19+/m1/s1 |
| InChIKey | NEECEUJQQHCPMD-BEFAXECRSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |