C24H24ClNOS — CID 92682333
(2S)-N,N-dibenzyl-2-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 92682333) has the molecular formula C24H24ClNOS and a molecular weight of 409.98 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 92682333 |
| Molecular Formula | C24H24ClNOS |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClNOS/c1-2-23(28-22-15-13-21(25)14-16-22)24(27)26(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20/h3-16,23H,2,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | PRHQDKGWVBHQCK-QHCPKHFHSA-N |
| XLogP | 6.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |