C19H22ClNOS2 — CID 43905507
N-(2-benzylsulfanylethyl)-2-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 43905507) has the molecular formula C19H22ClNOS2 and a molecular weight of 379.98 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 43905507 |
| Molecular Formula | C19H22ClNOS2 |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C19H22ClNOS2/c1-2-18(24-17-10-8-16(20)9-11-17)19(22)21-12-13-23-14-15-6-4-3-5-7-15/h3-11,18H,2,12-14H2,1H3,(H,21,22) |
| InChIKey | OELVPRNGTGUZSJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|