C19H21ClFNOS — CID 30394251
(2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-fluorophenyl)propyl]butanamide (PubChem CID 30394251) has the molecular formula C19H21ClFNOS and a molecular weight of 365.90 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-fluorophenyl)propyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-fluorophenyl)propyl]butanamide |
|---|---|
| PubChem CID | 30394251 |
| Molecular Formula | C19H21ClFNOS |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-fluorophenyl)propyl]butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)NCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21ClFNOS/c1-2-18(24-17-11-7-15(20)8-12-17)19(23)22-13-3-4-14-5-9-16(21)10-6-14/h5-12,18H,2-4,13H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | MWHUNKXORCDLCP-GOSISDBHSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|