C21H26ClNO2S — CID 132659536
2-(4-chlorophenyl)sulfanyl-N-[3-(4-ethoxyphenyl)propyl]butanamide (PubChem CID 132659536) has the molecular formula C21H26ClNO2S and a molecular weight of 391.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[3-(4-ethoxyphenyl)propyl]butanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(4-ethoxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 132659536 |
| Molecular Formula | C21H26ClNO2S |
| Molecular Weight | 391.96 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(4-ethoxyphenyl)propyl]butanamide |
| SMILES | CCOc1ccc(CCCNC(=O)C(CC)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H26ClNO2S/c1-3-20(26-19-13-9-17(22)10-14-19)21(24)23-15-5-6-16-7-11-18(12-8-16)25-4-2/h7-14,20H,3-6,15H2,1-2H3,(H,23,24) |
| InChIKey | LYLPOAFVOZYLFS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.96 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|