C21H26ClNOS — CID 99999958
(2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]propanamide (PubChem CID 99999958) has the molecular formula C21H26ClNOS and a molecular weight of 375.97 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]propanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 99999958 |
| Molecular Formula | C21H26ClNOS |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]propanamide |
| SMILES | CC(C)c1ccc(CCCNC(=O)[C@@H](C)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H26ClNOS/c1-15(2)18-8-6-17(7-9-18)5-4-14-23-21(24)16(3)25-20-12-10-19(22)11-13-20/h6-13,15-16H,4-5,14H2,1-3H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | WXWSHYVXYXPHOS-MRXNPFEDSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|