C20H24ClNOS2 — CID 30378708
(2R)-2-(4-chlorophenyl)sulfanyl-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 30378708) has the molecular formula C20H24ClNOS2 and a molecular weight of 394.01 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 30378708 |
| Molecular Formula | C20H24ClNOS2 |
| Molecular Weight | 394.01 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)NCCSCc1cccc(C)c1 |
| InChI | InChI=1S/C20H24ClNOS2/c1-3-19(25-18-9-7-17(21)8-10-18)20(23)22-11-12-24-14-16-6-4-5-15(2)13-16/h4-10,13,19H,3,11-12,14H2,1-2H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | BSSDTUSSZPSXJQ-LJQANCHMSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.01 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|