C21H26ClNOS — CID 28565969
(2S)-2-(4-chlorophenyl)sulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]butanamide (PubChem CID 28565969) has the molecular formula C21H26ClNOS and a molecular weight of 375.97 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]butanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]butanamide |
|---|---|
| PubChem CID | 28565969 |
| Molecular Formula | C21H26ClNOS |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[(1S)-3-methyl-1-phenylbutyl]butanamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)N[C@@H](CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H26ClNOS/c1-4-20(25-18-12-10-17(22)11-13-18)21(24)23-19(14-15(2)3)16-8-6-5-7-9-16/h5-13,15,19-20H,4,14H2,1-3H3,(H,23,24)/t19-,20-/m0/s1 |
| InChIKey | GVIBSYJZXUZTAB-PMACEKPBSA-N |
| XLogP | 6.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |