C21H26ClNO2S — CID 46771833
2-(4-chlorophenyl)sulfanyl-N-[1-(4-methoxyphenyl)-3-methylbutyl]propanamide (PubChem CID 46771833) has the molecular formula C21H26ClNO2S and a molecular weight of 391.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[1-(4-methoxyphenyl)-3-methylbutyl]propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[1-(4-methoxyphenyl)-3-methylbutyl]propanamide |
|---|---|
| PubChem CID | 46771833 |
| Molecular Formula | C21H26ClNO2S |
| Molecular Weight | 391.96 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[1-(4-methoxyphenyl)-3-methylbutyl]propanamide |
| SMILES | COc1ccc(C(CC(C)C)NC(=O)C(C)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H26ClNO2S/c1-14(2)13-20(16-5-9-18(25-4)10-6-16)23-21(24)15(3)26-19-11-7-17(22)8-12-19/h5-12,14-15,20H,13H2,1-4H3,(H,23,24) |
| InChIKey | NMSCPLMENBBXBS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.96 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |