C22H29NO2S — CID 94012975
(2S)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 94012975) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 94012975 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2S)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NC(=O)[C@H](C)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H29NO2S/c1-15(2)14-21(18-8-10-19(25-5)11-9-18)23-22(24)17(4)26-20-12-6-16(3)7-13-20/h6-13,15,17,21H,14H2,1-5H3,(H,23,24)/t17-,21+/m0/s1 |
| InChIKey | QJRSSXMJIYECOJ-LAUBAEHRSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |