C19H23NO2S2 — CID 30400150
(2R)-2-(4-methoxyphenyl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]propanamide (PubChem CID 30400150) has the molecular formula C19H23NO2S2 and a molecular weight of 361.53 g/mol. Its IUPAC name is (2R)-2-(4-methoxyphenyl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]propanamide.
| Compound Name | (2R)-2-(4-methoxyphenyl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 30400150 |
| Molecular Formula | C19H23NO2S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2R)-2-(4-methoxyphenyl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
| SMILES | COc1ccc(S[C@H](C)C(=O)NCCSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H23NO2S2/c1-14-4-8-17(9-5-14)23-13-12-20-19(21)15(2)24-18-10-6-16(22-3)7-11-18/h4-11,15H,12-13H2,1-3H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | MMUMECVEJDJSLV-OAHLLOKOSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|