C18H21NOS2 — CID 9483097
(2R)-2-(4-methylphenyl)sulfanyl-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 9483097) has the molecular formula C18H21NOS2 and a molecular weight of 331.51 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)sulfanyl-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | (2R)-2-(4-methylphenyl)sulfanyl-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 9483097 |
| Molecular Formula | C18H21NOS2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2R)-2-(4-methylphenyl)sulfanyl-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | Cc1ccc(S[C@H](C)C(=O)NCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NOS2/c1-14-8-10-17(11-9-14)22-15(2)18(20)19-12-13-21-16-6-4-3-5-7-16/h3-11,15H,12-13H2,1-2H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | JCSKHKMVBGKRQB-OAHLLOKOSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|