C19H22ClNO2S — CID 60506394
N-[1-(3-chlorophenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 60506394) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-[1-(3-chlorophenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 60506394 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[1-(3-chlorophenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | CCC(NC(=O)C(C)Sc1ccc(OC)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClNO2S/c1-4-18(14-6-5-7-15(20)12-14)21-19(22)13(2)24-17-10-8-16(23-3)9-11-17/h5-13,18H,4H2,1-3H3,(H,21,22) |
| InChIKey | SVMJGTIAAKSGNE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |