C22H20Cl2N2O3S2 — CID 30386688
(2S)-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 30386688) has the molecular formula C22H20Cl2N2O3S2 and a molecular weight of 495.45 g/mol. Its IUPAC name is (2S)-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | (2S)-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 30386688 |
| Molecular Formula | C22H20Cl2N2O3S2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | (2S)-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O3S2/c1-2-21(30-19-11-5-16(24)6-12-19)22(27)25-17-9-13-20(14-10-17)31(28,29)26-18-7-3-15(23)4-8-18/h3-14,21,26H,2H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | OTZTUSPWVUSCLO-NRFANRHFSA-N |
| XLogP | 6.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |