C20H14ClF2NOS — CID 3754740
N-[4-[(4-chlorophenyl)sulfanylmethyl]phenyl]-2,4-difluorobenzamide (PubChem CID 3754740) has the molecular formula C20H14ClF2NOS and a molecular weight of 389.85 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfanylmethyl]phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfanylmethyl]phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 3754740 |
| Molecular Formula | C20H14ClF2NOS |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfanylmethyl]phenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(CSc2ccc(Cl)cc2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H14ClF2NOS/c21-14-3-8-17(9-4-14)26-12-13-1-6-16(7-2-13)24-20(25)18-10-5-15(22)11-19(18)23/h1-11H,12H2,(H,24,25) |
| InChIKey | GSRJKQTWNHYEBW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |