C18H13ClFNO2S — CID 2804180
5-[(4-chlorophenyl)sulfanylmethyl]-N-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 2804180) has the molecular formula C18H13ClFNO2S and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfanylmethyl]-N-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)sulfanylmethyl]-N-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2804180 |
| Molecular Formula | C18H13ClFNO2S |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfanylmethyl]-N-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(CSc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C18H13ClFNO2S/c19-12-1-8-16(9-2-12)24-11-15-7-10-17(23-15)18(22)21-14-5-3-13(20)4-6-14/h1-10H,11H2,(H,21,22) |
| InChIKey | HJVCNPHUVXWDMA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |