C21H16FNO3S — CID 22784520
2-[[4-[(2-fluorophenyl)methylsulfanyl]phenyl]carbamoyl]benzoic acid (PubChem CID 22784520) has the molecular formula C21H16FNO3S and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[[4-[(2-fluorophenyl)methylsulfanyl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[(2-fluorophenyl)methylsulfanyl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22784520 |
| Molecular Formula | C21H16FNO3S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[[4-[(2-fluorophenyl)methylsulfanyl]phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(SCc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H16FNO3S/c22-19-8-4-1-5-14(19)13-27-16-11-9-15(10-12-16)23-20(24)17-6-2-3-7-18(17)21(25)26/h1-12H,13H2,(H,23,24)(H,25,26) |
| InChIKey | XWSLFZZWBCKDNV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |