C24H21N3O5S — CID 22785321
2-[[4-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22785321) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[[4-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22785321 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-[[4-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2ccc(NC(=O)c3ccccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-15(28)25-16-6-8-17(9-7-16)26-22(29)14-33-19-12-10-18(11-13-19)27-23(30)20-4-2-3-5-21(20)24(31)32/h2-13H,14H2,1H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | YAOIKPLAZDCNBC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |