C24H20N2O6S — CID 22785327
3-[[2-[4-[(2-carboxybenzoyl)amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid (PubChem CID 22785327) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is 3-[[2-[4-[(2-carboxybenzoyl)amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[4-[(2-carboxybenzoyl)amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22785327 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[[2-[4-[(2-carboxybenzoyl)amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)CSc1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H20N2O6S/c1-14-6-7-15(23(29)30)12-20(14)26-21(27)13-33-17-10-8-16(9-11-17)25-22(28)18-4-2-3-5-19(18)24(31)32/h2-12H,13H2,1H3,(H,25,28)(H,26,27)(H,29,30)(H,31,32) |
| InChIKey | CESNMKADTQAEQQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |