C26H20N2O4S — CID 22785296
2-[[4-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22785296) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-[[4-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22785296 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[[4-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccccc2C(=O)O)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C26H20N2O4S/c29-24(28-23-11-5-7-17-6-1-2-8-20(17)23)16-33-19-14-12-18(13-15-19)27-25(30)21-9-3-4-10-22(21)26(31)32/h1-15H,16H2,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | HPHBOJCIIBOUCE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |