C30H20N2O6S — CID 22784826
2-[[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22784826) has the molecular formula C30H20N2O6S and a molecular weight of 536.57 g/mol. Its IUPAC name is 2-[[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22784826 |
| Molecular Formula | C30H20N2O6S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-[[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccccc2C(=O)O)cc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H20N2O6S/c33-25(32-24-11-5-10-23-26(24)28(35)20-7-2-1-6-19(20)27(23)34)16-39-18-14-12-17(13-15-18)31-29(36)21-8-3-4-9-22(21)30(37)38/h1-15H,16H2,(H,31,36)(H,32,33)(H,37,38) |
| InChIKey | AYCJDLLHSFCYOO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|