C30H22N2O4S — CID 23100673
N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 23100673) has the molecular formula C30H22N2O4S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23100673 |
| Molecular Formula | C30H22N2O4S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C30H22N2O4S/c33-26(17-19-7-2-1-3-8-19)31-20-13-15-21(16-14-20)37-18-27(34)32-25-12-6-11-24-28(25)30(36)23-10-5-4-9-22(23)29(24)35/h1-16H,17-18H2,(H,31,33)(H,32,34) |
| InChIKey | IDRXPGAEGOXEMK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|