C22H21N3O4S2 — CID 23094842
N-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 23094842) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23094842 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O4S2/c23-31(28,29)20-12-8-18(9-13-20)25-22(27)15-30-19-10-6-17(7-11-19)24-21(26)14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,24,26)(H,25,27)(H2,23,28,29) |
| InChIKey | FWOWCMNTJCLLMW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |