C18H17N3O6S2 — CID 22786162
(E)-4-oxo-4-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]but-2-enoic acid (PubChem CID 22786162) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 22786162 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (E)-4-oxo-4-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]but-2-enoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O6S2/c19-29(26,27)15-7-3-13(4-8-15)21-17(23)11-28-14-5-1-12(2-6-14)20-16(22)9-10-18(24)25/h1-10H,11H2,(H,20,22)(H,21,23)(H,24,25)(H2,19,26,27)/b10-9+ |
| InChIKey | XCKALYODAALGOX-MDZDMXLPSA-N |
| XLogP | 1.64 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|