C20H16N2O8S — CID 92856125
(Z)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfonylanilino]-4-oxobut-2-enoic acid (PubChem CID 92856125) has the molecular formula C20H16N2O8S and a molecular weight of 444.42 g/mol. Its IUPAC name is (Z)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfonylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfonylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 92856125 |
| Molecular Formula | C20H16N2O8S |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (Z)-4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfonylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(=O)/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O8S/c23-17(9-11-19(25)26)21-13-1-5-15(6-2-13)31(29,30)16-7-3-14(4-8-16)22-18(24)10-12-20(27)28/h1-12H,(H,21,23)(H,22,24)(H,25,26)(H,27,28)/b11-9-,12-10+ |
| InChIKey | NDVQFCYOAORVKK-DSOJMZEYSA-N |
| XLogP | 1.68 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|