C14H16N2O6S — CID 2144801
(Z)-4-(4-morpholin-4-ylsulfonylanilino)-4-oxobut-2-enoic acid (PubChem CID 2144801) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is (Z)-4-(4-morpholin-4-ylsulfonylanilino)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(4-morpholin-4-ylsulfonylanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2144801 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (Z)-4-(4-morpholin-4-ylsulfonylanilino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H16N2O6S/c17-13(5-6-14(18)19)15-11-1-3-12(4-2-11)23(20,21)16-7-9-22-10-8-16/h1-6H,7-10H2,(H,15,17)(H,18,19)/b6-5- |
| InChIKey | FCZQPDJNVDOUNL-WAYWQWQTSA-N |
| XLogP | 0.29 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|