C19H20N2O4S — CID 2139660
(Z)-N-(4-morpholin-4-ylsulfonylphenyl)-3-phenylprop-2-enamide (PubChem CID 2139660) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (Z)-N-(4-morpholin-4-ylsulfonylphenyl)-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-(4-morpholin-4-ylsulfonylphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2139660 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (Z)-N-(4-morpholin-4-ylsulfonylphenyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c22-19(11-6-16-4-2-1-3-5-16)20-17-7-9-18(10-8-17)26(23,24)21-12-14-25-15-13-21/h1-11H,12-15H2,(H,20,22)/b11-6- |
| InChIKey | HMTIRYWZBAFZDT-WDZFZDKYSA-N |
| XLogP | 2.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|