C11H9F3N2O8S2 — CID 162609504
(Z)-4-[4-[hydroxy(trifluoromethylsulfonyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 162609504) has the molecular formula C11H9F3N2O8S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is (Z)-4-[4-[hydroxy(trifluoromethylsulfonyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[hydroxy(trifluoromethylsulfonyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162609504 |
| Molecular Formula | C11H9F3N2O8S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | (Z)-4-[4-[hydroxy(trifluoromethylsulfonyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(S(=O)(=O)N(O)S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3N2O8S2/c12-11(13,14)26(23,24)16(20)25(21,22)8-3-1-7(2-4-8)15-9(17)5-6-10(18)19/h1-6,20H,(H,15,17)(H,18,19)/b6-5- |
| InChIKey | UTCHBUFRBQIJPP-WAYWQWQTSA-N |
| XLogP | 0.50 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|