About cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid
cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid (PubChem CID 67574152) has the molecular formula C10H9CoNO4
and a molecular weight of 266.12 g/mol. Its IUPAC name is cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid |
| PubChem CID | 67574152 |
| Molecular Formula | C10H9CoNO4 |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(O)cc1.[Co] |
| InChI | InChI=1S/C10H9NO4.Co/c12-8-3-1-7(2-4-8)11-9(13)5-6-10(14)15;/h1-6,12H,(H,11,13)(H,14,15);/b6-5-; |
| InChIKey | XQKPORSNYSRJIE-YSMBQZINSA-N |
| XLogP | 0.97 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid?
The IUPAC name of cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid (CID 67574152) is cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid.
What is the SMILES notation for cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid?
The canonical SMILES for cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid is O=C(O)/C=C\C(=O)Nc1ccc(O)cc1.[Co].
What is the InChIKey of cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid?
The InChIKey is XQKPORSNYSRJIE-YSMBQZINSA-N. The full InChI is InChI=1S/C10H9NO4.Co/c12-8-3-1-7(2-4-8)11-9(13)5-6-10(14)15;/h1-6,12H,(H,11,13)(H,14,15);/b6-5-;.
What are the key properties of cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid?
cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid has a molecular weight of 266.12 g/mol, XLogP of 0.97, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;(Z)-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid is sourced from PubChem (CID 67574152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).