C16H14N2O4 — CID 5356642
(E)-N,N'-bis(4-hydroxyphenyl)but-2-enediamide (PubChem CID 5356642) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (E)-N,N'-bis(4-hydroxyphenyl)but-2-enediamide.
| Compound Name | (E)-N,N'-bis(4-hydroxyphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 5356642 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (E)-N,N'-bis(4-hydroxyphenyl)but-2-enediamide |
| SMILES | O=C(/C=C/C(=O)Nc1ccc(O)cc1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H14N2O4/c19-13-5-1-11(2-6-13)17-15(21)9-10-16(22)18-12-3-7-14(20)8-4-12/h1-10,19-20H,(H,17,21)(H,18,22)/b10-9+ |
| InChIKey | WXOYACGTOHRQCZ-MDZDMXLPSA-N |
| XLogP | 2.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|