C10H9NO3S — CID 70007709
(Z)-4-oxo-4-(4-sulfanylanilino)but-2-enoic acid (PubChem CID 70007709) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is (Z)-4-oxo-4-(4-sulfanylanilino)but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-(4-sulfanylanilino)but-2-enoic acid |
|---|---|
| PubChem CID | 70007709 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | (Z)-4-oxo-4-(4-sulfanylanilino)but-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C10H9NO3S/c12-9(5-6-10(13)14)11-7-1-3-8(15)4-2-7/h1-6,15H,(H,11,12)(H,13,14)/b6-5- |
| InChIKey | QUKVNCUSSBLESP-WAYWQWQTSA-N |
| XLogP | 1.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|