C14H16N2O4 — CID 17202441
(E)-4-[4-(butanoylamino)anilino]-4-oxobut-2-enoic acid (PubChem CID 17202441) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (E)-4-[4-(butanoylamino)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-(butanoylamino)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 17202441 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (E)-4-[4-(butanoylamino)anilino]-4-oxobut-2-enoic acid |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-2-3-12(17)15-10-4-6-11(7-5-10)16-13(18)8-9-14(19)20/h4-9H,2-3H2,1H3,(H,15,17)(H,16,18)(H,19,20)/b9-8+ |
| InChIKey | REGMIBGNDSSTHN-CMDGGOBGSA-N |
| XLogP | 2.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|