C11H11NO4 — CID 126969715
4-[4-(hydroxymethyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 126969715) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-(hydroxymethyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 126969715 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-[4-(hydroxymethyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C11H11NO4/c13-7-8-1-3-9(4-2-8)12-10(14)5-6-11(15)16/h1-6,13H,7H2,(H,12,14)(H,15,16) |
| InChIKey | WZHNKWMVTJPCFI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|