C20H16N2O6Se2 — CID 118736424
(Z)-4-[4-[[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]diselanyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 118736424) has the molecular formula C20H16N2O6Se2 and a molecular weight of 538.28 g/mol. Its IUPAC name is (Z)-4-[4-[[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]diselanyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]diselanyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 118736424 |
| Molecular Formula | C20H16N2O6Se2 |
| Molecular Weight | 538.28 g/mol |
| Exact Mass | 539.93 |
| IUPAC Name | (Z)-4-[4-[[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]diselanyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc([Se][Se]c2ccc(NC(=O)/C=C\C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O6Se2/c23-17(9-11-19(25)26)21-13-1-5-15(6-2-13)29-30-16-7-3-14(4-8-16)22-18(24)10-12-20(27)28/h1-12H,(H,21,23)(H,22,24)(H,25,26)(H,27,28)/b11-9-,12-10- |
| InChIKey | OKCSDWKTIQNPRL-HWAYABPNSA-N |
| XLogP | 0.12 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|