C11H8N2O3Se — CID 118736418
(Z)-4-oxo-4-(4-selenocyanatoanilino)but-2-enoic acid (PubChem CID 118736418) has the molecular formula C11H8N2O3Se and a molecular weight of 295.16 g/mol. Its IUPAC name is (Z)-4-oxo-4-(4-selenocyanatoanilino)but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-(4-selenocyanatoanilino)but-2-enoic acid |
|---|---|
| PubChem CID | 118736418 |
| Molecular Formula | C11H8N2O3Se |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | (Z)-4-oxo-4-(4-selenocyanatoanilino)but-2-enoic acid |
| SMILES | N#C[Se]c1ccc(NC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C11H8N2O3Se/c12-7-17-9-3-1-8(2-4-9)13-10(14)5-6-11(15)16/h1-6H,(H,13,14)(H,15,16)/b6-5- |
| InChIKey | QJDLUDLXQWOCMQ-WAYWQWQTSA-N |
| XLogP | 0.08 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|