C29H23N3O6 — CID 155460120
(E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]-1-(4-cyanophenyl)ethyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 155460120) has the molecular formula C29H23N3O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]-1-(4-cyanophenyl)ethyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]-1-(4-cyanophenyl)ethyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 155460120 |
| Molecular Formula | C29H23N3O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (E)-4-[4-[1-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]-1-(4-cyanophenyl)ethyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | CC(c1ccc(C#N)cc1)(c1ccc(NC(=O)/C=C/C(=O)O)cc1)c1ccc(NC(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C29H23N3O6/c1-29(20-4-2-19(18-30)3-5-20,21-6-10-23(11-7-21)31-25(33)14-16-27(35)36)22-8-12-24(13-9-22)32-26(34)15-17-28(37)38/h2-17H,1H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38)/b16-14+,17-15+ |
| InChIKey | ZFDPJFWPOGHLNK-YXLFCKQPSA-N |
| XLogP | 4.07 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|