C13H15N3O2 — CID 108506832
N'-tert-butyl-N-(4-cyanophenyl)oxamide (PubChem CID 108506832) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N'-tert-butyl-N-(4-cyanophenyl)oxamide.
| Compound Name | N'-tert-butyl-N-(4-cyanophenyl)oxamide |
|---|---|
| PubChem CID | 108506832 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N'-tert-butyl-N-(4-cyanophenyl)oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H15N3O2/c1-13(2,3)16-12(18)11(17)15-10-6-4-9(8-14)5-7-10/h4-7H,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | IIQIQTSXQLOHKK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|